C17H11F2NO7 — CID 135511138
(Z)-3-[5-[(2,4-difluoro-3-oxalophenyl)methoxy]-2-pyridinyl]-2-hydroxyprop-2-enoic acid (PubChem CID 135511138) has the molecular formula C17H11F2NO7 and a molecular weight of 379.27 g/mol. Its IUPAC name is (Z)-3-[5-[(2,4-difluoro-3-oxalophenyl)methoxy]-2-pyridinyl]-2-hydroxyprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[(2,4-difluoro-3-oxalophenyl)methoxy]-2-pyridinyl]-2-hydroxyprop-2-enoic acid |
|---|---|
| PubChem CID | 135511138 |
| Molecular Formula | C17H11F2NO7 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (Z)-3-[5-[(2,4-difluoro-3-oxalophenyl)methoxy]-2-pyridinyl]-2-hydroxyprop-2-enoic acid |
| SMILES | O=C(O)C(=O)c1c(F)ccc(COc2ccc(/C=C(\O)C(=O)O)nc2)c1F |
| InChI | InChI=1S/C17H11F2NO7/c18-11-4-1-8(14(19)13(11)15(22)17(25)26)7-27-10-3-2-9(20-6-10)5-12(21)16(23)24/h1-6,21H,7H2,(H,23,24)(H,25,26)/b12-5- |
| InChIKey | BYNYCFYHAJOFLP-XGICHPGQSA-N |
| XLogP | 2.19 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|