C13H12O2S2 — CID 135511326
2-hydroxy-6-oxo-4-phenylcyclohexene-1-carbodithioic acid (PubChem CID 135511326) has the molecular formula C13H12O2S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-4-phenylcyclohexene-1-carbodithioic acid.
| Compound Name | 2-hydroxy-6-oxo-4-phenylcyclohexene-1-carbodithioic acid |
|---|---|
| PubChem CID | 135511326 |
| Molecular Formula | C13H12O2S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-hydroxy-6-oxo-4-phenylcyclohexene-1-carbodithioic acid |
| SMILES | O=C1CC(c2ccccc2)CC(O)=C1C(=S)S |
| InChI | InChI=1S/C13H12O2S2/c14-10-6-9(8-4-2-1-3-5-8)7-11(15)12(10)13(16)17/h1-5,9,14H,6-7H2,(H,16,17) |
| InChIKey | HMLDWAFETMEGJU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|