C17H14ClF3N4O2 — CID 135513280
2-[(4-amino-5-chloro-2-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one (PubChem CID 135513280) has the molecular formula C17H14ClF3N4O2 and a molecular weight of 398.77 g/mol. Its IUPAC name is 2-[(4-amino-5-chloro-2-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one.
| Compound Name | 2-[(4-amino-5-chloro-2-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 135513280 |
| Molecular Formula | C17H14ClF3N4O2 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(4-amino-5-chloro-2-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| SMILES | COc1cc(N)c(Cl)cc1Cn1nc(-c2ccc(C(F)(F)F)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H14ClF3N4O2/c1-27-14-7-13(22)12(18)6-10(14)8-25-16(26)23-15(24-25)9-2-4-11(5-3-9)17(19,20)21/h2-7H,8,22H2,1H3,(H,23,24,26) |
| InChIKey | AWZSGTJREBHJAO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|