C17H13ClF3N2O4P — CID 70021937
3-[[5-chloro-2-(phosphanyloxymethoxy)phenyl]methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one (PubChem CID 70021937) has the molecular formula C17H13ClF3N2O4P and a molecular weight of 432.72 g/mol. Its IUPAC name is 3-[[5-chloro-2-(phosphanyloxymethoxy)phenyl]methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[[5-chloro-2-(phosphanyloxymethoxy)phenyl]methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 70021937 |
| Molecular Formula | C17H13ClF3N2O4P |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 3-[[5-chloro-2-(phosphanyloxymethoxy)phenyl]methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(-c2ccc(C(F)(F)F)cc2)nn1Cc1cc(Cl)ccc1OCOP |
| InChI | InChI=1S/C17H13ClF3N2O4P/c18-13-5-6-14(25-9-26-28)11(7-13)8-23-16(24)27-15(22-23)10-1-3-12(4-2-10)17(19,20)21/h1-7H,8-9,28H2 |
| InChIKey | WNMICHHJQDFERN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|