C24H27ClF3N3O5 — CID 162621326
3-[(5-chloro-2-hydroxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one;3-[diethyl(methyl)azaniumyl]propanoate (PubChem CID 162621326) has the molecular formula C24H27ClF3N3O5 and a molecular weight of 529.94 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one;3-[diethyl(methyl)azaniumyl]propanoate.
| Compound Name | 3-[(5-chloro-2-hydroxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one;3-[diethyl(methyl)azaniumyl]propanoate |
|---|---|
| PubChem CID | 162621326 |
| Molecular Formula | C24H27ClF3N3O5 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 3-[(5-chloro-2-hydroxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-one;3-[diethyl(methyl)azaniumyl]propanoate |
| SMILES | CC[N+](C)(CC)CCC(=O)[O-].O=c1oc(-c2ccc(C(F)(F)F)cc2)nn1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H10ClF3N2O3.C8H17NO2/c17-12-5-6-13(23)10(7-12)8-22-15(24)25-14(21-22)9-1-3-11(4-2-9)16(18,19)20;1-4-9(3,5-2)7-6-8(10)11/h1-7,23H,8H2;4-7H2,1-3H3 |
| InChIKey | OPMNNKPYBVHRRD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|