C10H9N3O3S — CID 135514979
4-amino-2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 135514979) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-amino-2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135514979 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 4-amino-2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C10H9N3O3S/c11-8-4-9(15)13-10(12-8)17-5-6(14)7-2-1-3-16-7/h1-4H,5H2,(H3,11,12,13,15) |
| InChIKey | UWYHETYFTOWMAD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |