C10H8N2O3S — CID 2399528
2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 2399528) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 2399528 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | O=C(CSc1nccc(=O)[nH]1)c1ccco1 |
| InChI | InChI=1S/C10H8N2O3S/c13-7(8-2-1-5-15-8)6-16-10-11-4-3-9(14)12-10/h1-5H,6H2,(H,11,12,14) |
| InChIKey | DGBOUTSOKIDUAI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |