C13H15ClN2O3 — CID 135516629
2-(chloromethyl)-6,7-diethoxy-3H-quinazolin-4-one (PubChem CID 135516629) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-(chloromethyl)-6,7-diethoxy-3H-quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-6,7-diethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135516629 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(chloromethyl)-6,7-diethoxy-3H-quinazolin-4-one |
| SMILES | CCOc1cc2nc(CCl)[nH]c(=O)c2cc1OCC |
| InChI | InChI=1S/C13H15ClN2O3/c1-3-18-10-5-8-9(6-11(10)19-4-2)15-12(7-14)16-13(8)17/h5-6H,3-4,7H2,1-2H3,(H,15,16,17) |
| InChIKey | JYQNIHDJGLSQFS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|