C25H24N4O4 — CID 135517208
2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135517208) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135517208 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cc2nc3ccccc3n2CC(=O)N/N=C/c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C25H24N4O4/c1-32-22-12-9-18(13-23(22)33-2)14-24-27-20-5-3-4-6-21(20)29(24)16-25(31)28-26-15-17-7-10-19(30)11-8-17/h3-13,15,30H,14,16H2,1-2H3,(H,28,31)/b26-15+ |
| InChIKey | SYDUDAYIUHMYJI-CVKSISIWSA-N |
| XLogP | 3.50 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|