C21H21N5O6 — CID 135517463
2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (PubChem CID 135517463) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135517463 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc2ccc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H21N5O6/c22-21-25-15-6-1-11(9-14(15)19(30)26-21)10-23-13-4-2-12(3-5-13)18(29)24-16(20(31)32)7-8-17(27)28/h1-6,9,16,23H,7-8,10H2,(H,24,29)(H,27,28)(H,31,32)(H3,22,25,26,30) |
| InChIKey | UQFCLENKCDVITL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 187.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |