C9H6ClN3O — CID 135518891
6-(4-chlorophenyl)-4H-1,2,4-triazin-5-one (PubChem CID 135518891) has the molecular formula C9H6ClN3O and a molecular weight of 207.62 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(4-chlorophenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135518891 |
| Molecular Formula | C9H6ClN3O |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 6-(4-chlorophenyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]cnnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6ClN3O/c10-7-3-1-6(2-4-7)8-9(14)11-5-12-13-8/h1-5H,(H,11,12,14) |
| InChIKey | JLCZPDRWVRCNHU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |