C15H9Cl2N3O — CID 135463342
3,6-bis(4-chlorophenyl)-4H-1,2,4-triazin-5-one (PubChem CID 135463342) has the molecular formula C15H9Cl2N3O and a molecular weight of 318.16 g/mol. Its IUPAC name is 3,6-bis(4-chlorophenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3,6-bis(4-chlorophenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135463342 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3,6-bis(4-chlorophenyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H9Cl2N3O/c16-11-5-1-9(2-6-11)13-15(21)18-14(20-19-13)10-3-7-12(17)8-4-10/h1-8H,(H,18,20,21) |
| InChIKey | VIOWOTPNAJGWGQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |