C18H15N5O2 — CID 135520113
6-[1-(2-hydroxyethyl)-3-pyridin-4-ylpyrazol-4-yl]-3H-quinazolin-4-one (PubChem CID 135520113) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 6-[1-(2-hydroxyethyl)-3-pyridin-4-ylpyrazol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 6-[1-(2-hydroxyethyl)-3-pyridin-4-ylpyrazol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135520113 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 6-[1-(2-hydroxyethyl)-3-pyridin-4-ylpyrazol-4-yl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2ccc(-c3cn(CCO)nc3-c3ccncc3)cc12 |
| InChI | InChI=1S/C18H15N5O2/c24-8-7-23-10-15(17(22-23)12-3-5-19-6-4-12)13-1-2-16-14(9-13)18(25)21-11-20-16/h1-6,9-11,24H,7-8H2,(H,20,21,25) |
| InChIKey | CUMVKNXOPPUONI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |