C16H13FN4O3S — CID 135521498
(2Z)-N-(4-fluorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135521498) has the molecular formula C16H13FN4O3S and a molecular weight of 360.37 g/mol. Its IUPAC name is (2Z)-N-(4-fluorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (2Z)-N-(4-fluorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135521498 |
| Molecular Formula | C16H13FN4O3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (2Z)-N-(4-fluorophenyl)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc(F)cc2)S/C(=N\N=C\c2ccco2)N1 |
| InChI | InChI=1S/C16H13FN4O3S/c17-10-3-5-11(6-4-10)19-15(23)13-8-14(22)20-16(25-13)21-18-9-12-2-1-7-24-12/h1-7,9,13H,8H2,(H,19,23)(H,20,21,22)/b18-9+ |
| InChIKey | IOVLFZXNEIGECK-GIJQJNRQSA-N |
| XLogP | 2.37 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|