C23H17BrN4O2 — CID 135521679
N-[(E)-[(5E)-5-benzylidene-4-oxo-1-phenylimidazolidin-2-ylidene]amino]-4-bromobenzamide (PubChem CID 135521679) has the molecular formula C23H17BrN4O2 and a molecular weight of 461.32 g/mol. Its IUPAC name is N-[(E)-[(5E)-5-benzylidene-4-oxo-1-phenylimidazolidin-2-ylidene]amino]-4-bromobenzamide.
| Compound Name | N-[(E)-[(5E)-5-benzylidene-4-oxo-1-phenylimidazolidin-2-ylidene]amino]-4-bromobenzamide |
|---|---|
| PubChem CID | 135521679 |
| Molecular Formula | C23H17BrN4O2 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[(E)-[(5E)-5-benzylidene-4-oxo-1-phenylimidazolidin-2-ylidene]amino]-4-bromobenzamide |
| SMILES | O=C1N/C(=N\NC(=O)c2ccc(Br)cc2)N(c2ccccc2)/C1=C/c1ccccc1 |
| InChI | InChI=1S/C23H17BrN4O2/c24-18-13-11-17(12-14-18)21(29)26-27-23-25-22(30)20(15-16-7-3-1-4-8-16)28(23)19-9-5-2-6-10-19/h1-15H,(H,26,29)(H,25,27,30)/b20-15+ |
| InChIKey | PLFVVEKDRSAZDZ-HMMYKYKNSA-N |
| XLogP | 4.13 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|