C13H12ClN5 — CID 135521878
7-chloro-N-methyl-5-(1H-pyrazol-4-yl)-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 135521878) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 7-chloro-N-methyl-5-(1H-pyrazol-4-yl)-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | 7-chloro-N-methyl-5-(1H-pyrazol-4-yl)-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 135521878 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 7-chloro-N-methyl-5-(1H-pyrazol-4-yl)-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | C/N=C1\CN=C(c2cn[nH]c2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C13H12ClN5/c1-15-12-7-16-13(8-5-17-18-6-8)10-4-9(14)2-3-11(10)19-12/h2-6H,7H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | GPWOJYKSDKXMSD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|