C14H17ClN4 — CID 142601329
1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane (PubChem CID 142601329) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane.
| Compound Name | 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 142601329 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1,4-diazepane |
| SMILES | Clc1cccc(-c2[nH]ncc2N2CCCNCC2)c1 |
| InChI | InChI=1S/C14H17ClN4/c15-12-4-1-3-11(9-12)14-13(10-17-18-14)19-7-2-5-16-6-8-19/h1,3-4,9-10,16H,2,5-8H2,(H,17,18) |
| InChIKey | QYUZYZBBJGTSFR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |