C21H21N3O2S — CID 135524045
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1,2-dihydropyrazole-3-thione (PubChem CID 135524045) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1,2-dihydropyrazole-3-thione.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1,2-dihydropyrazole-3-thione |
|---|---|
| PubChem CID | 135524045 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1,2-dihydropyrazole-3-thione |
| SMILES | CC(C)c1cc(-c2[nH][nH]c(=S)c2-c2ccc3c(ccn3C)c2)c(O)cc1O |
| InChI | InChI=1S/C21H21N3O2S/c1-11(2)14-9-15(18(26)10-17(14)25)20-19(21(27)23-22-20)13-4-5-16-12(8-13)6-7-24(16)3/h4-11,25-26H,1-3H3,(H2,22,23,27) |
| InChIKey | QNASPKYIXRLTSE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|