C20H20IN3O2S — CID 143232512
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1λ3-ioda-2,4-diazacyclopent-5-ene-3-thione (PubChem CID 143232512) has the molecular formula C20H20IN3O2S and a molecular weight of 493.37 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1λ3-ioda-2,4-diazacyclopent-5-ene-3-thione.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1λ3-ioda-2,4-diazacyclopent-5-ene-3-thione |
|---|---|
| PubChem CID | 143232512 |
| Molecular Formula | C20H20IN3O2S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(1-methylindol-5-yl)-1λ3-ioda-2,4-diazacyclopent-5-ene-3-thione |
| SMILES | CC(C)c1cc(C2=INC(=S)N2c2ccc3c(ccn3C)c2)c(O)cc1O |
| InChI | InChI=1S/C20H20IN3O2S/c1-11(2)14-9-15(18(26)10-17(14)25)19-21-22-20(27)24(19)13-4-5-16-12(8-13)6-7-23(16)3/h4-11,25-26H,1-3H3,(H,22,27) |
| InChIKey | UGXNGBVRNGTITQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|