C52H38N5+ — CID 135524758
7-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 135524758) has the molecular formula C52H38N5+ and a molecular weight of 732.91 g/mol. Its IUPAC name is 7-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 7-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135524758 |
| Molecular Formula | C52H38N5+ |
| Molecular Weight | 732.91 g/mol |
| Exact Mass | 732.31 |
| IUPAC Name | 7-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | C[n+]1ccc(/C=C/C2=Cc3nc2c(-c2ccccc2)c2ccc([nH]2)c(-c2ccccc2)c2nc(c(-c4ccccc4)c4ccc([nH]4)c3-c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C52H37N5/c1-57-32-30-35(31-33-57)22-23-40-34-47-50(38-18-10-4-11-19-38)45-27-26-43(54-45)48(36-14-6-2-7-15-36)41-24-25-42(53-41)49(37-16-8-3-9-17-37)44-28-29-46(55-44)51(52(40)56-47)39-20-12-5-13-21-39/h2-34H,1H3,(H,53,54,55,56)/p+1/b50-45- |
| InChIKey | XCMBQWRKANNLHC-JDKRGUCDSA-O |
| XLogP | 12.23 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.91 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|