C32H30N4O6 — CID 135525172
2-hydroxy-3-[2-[[2-hydroxy-3-[(4-methoxyphenyl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 135525172) has the molecular formula C32H30N4O6 and a molecular weight of 566.61 g/mol. Its IUPAC name is 2-hydroxy-3-[2-[[2-hydroxy-3-[(4-methoxyphenyl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 2-hydroxy-3-[2-[[2-hydroxy-3-[(4-methoxyphenyl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 135525172 |
| Molecular Formula | C32H30N4O6 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-hydroxy-3-[2-[[2-hydroxy-3-[(4-methoxyphenyl)carbamoyl]phenyl]methylideneamino]ethyliminomethyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(/C=N/CC/N=C/c3cccc(C(=O)Nc4ccc(OC)cc4)c3O)c2O)cc1 |
| InChI | InChI=1S/C32H30N4O6/c1-41-25-13-9-23(10-14-25)35-31(39)27-7-3-5-21(29(27)37)19-33-17-18-34-20-22-6-4-8-28(30(22)38)32(40)36-24-11-15-26(42-2)16-12-24/h3-16,19-20,37-38H,17-18H2,1-2H3,(H,35,39)(H,36,40)/b33-19+,34-20+ |
| InChIKey | MCLREUKHVQDFNE-ZXHXELASSA-N |
| XLogP | 5.16 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|