C22H26N4O6 — CID 136744167
3-[2-[2-[2-[(3-carboxy-2-hydroxyphenyl)methylideneamino]ethylamino]ethylamino]ethyliminomethyl]-2-hydroxybenzoic acid (PubChem CID 136744167) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-[2-[2-[2-[(3-carboxy-2-hydroxyphenyl)methylideneamino]ethylamino]ethylamino]ethyliminomethyl]-2-hydroxybenzoic acid.
| Compound Name | 3-[2-[2-[2-[(3-carboxy-2-hydroxyphenyl)methylideneamino]ethylamino]ethylamino]ethyliminomethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136744167 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[2-[2-[2-[(3-carboxy-2-hydroxyphenyl)methylideneamino]ethylamino]ethylamino]ethyliminomethyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(/C=N/CCNCCNCC/N=C/c2cccc(C(=O)O)c2O)c1O |
| InChI | InChI=1S/C22H26N4O6/c27-19-15(3-1-5-17(19)21(29)30)13-25-11-9-23-7-8-24-10-12-26-14-16-4-2-6-18(20(16)28)22(31)32/h1-6,13-14,23-24,27-28H,7-12H2,(H,29,30)(H,31,32)/b25-13+,26-14+ |
| InChIKey | KXIUKJOZOLHTEK-BKHCZYBLSA-N |
| XLogP | 1.21 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|