C14H20ClN3O3S — CID 172932162
3-[[(Z)-[amino(pentylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid;hydrochloride (PubChem CID 172932162) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is 3-[[(Z)-[amino(pentylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[[(Z)-[amino(pentylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 172932162 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[[(Z)-[amino(pentylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid;hydrochloride |
| SMILES | CCCCCS/C(N)=N\N=Cc1cccc(C(=O)O)c1O.Cl |
| InChI | InChI=1S/C14H19N3O3S.ClH/c1-2-3-4-8-21-14(15)17-16-9-10-6-5-7-11(12(10)18)13(19)20;/h5-7,9,18H,2-4,8H2,1H3,(H2,15,17)(H,19,20);1H |
| InChIKey | NFBFQQIQLKTWDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|