C25H41N3O3S — CID 135557867
octyl 3-[(E)-[(E)-[amino(octylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoate (PubChem CID 135557867) has the molecular formula C25H41N3O3S and a molecular weight of 463.69 g/mol. Its IUPAC name is octyl 3-[(E)-[(E)-[amino(octylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoate.
| Compound Name | octyl 3-[(E)-[(E)-[amino(octylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 135557867 |
| Molecular Formula | C25H41N3O3S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | octyl 3-[(E)-[(E)-[amino(octylsulfanyl)methylidene]hydrazinylidene]methyl]-2-hydroxybenzoate |
| SMILES | CCCCCCCCOC(=O)c1cccc(/C=N/N=C(\N)SCCCCCCCC)c1O |
| InChI | InChI=1S/C25H41N3O3S/c1-3-5-7-9-11-13-18-31-24(30)22-17-15-16-21(23(22)29)20-27-28-25(26)32-19-14-12-10-8-6-4-2/h15-17,20,29H,3-14,18-19H2,1-2H3,(H2,26,28)/b27-20+ |
| InChIKey | UIECIHKBTYAGNG-NHFJDJAPSA-N |
| XLogP | 6.65 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|