About CID 70118129
CID 70118129 (PubChem CID 70118129) has the molecular formula C7H5O3Si
and a molecular weight of 165.20 g/mol.
Molecular Properties
| Compound Name | CID 70118129 |
| PubChem CID | 70118129 |
| Molecular Formula | C7H5O3Si |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.00 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cccc([Si])c1O |
| InChI | InChI=1S/C7H5O3Si/c8-6-4(7(9)10)2-1-3-5(6)11/h1-3,8H,(H,9,10) |
| InChIKey | UGRHCPVHLZWTTI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70118129 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70118129?
The IUPAC name of CID 70118129 (CID 70118129) is not available.
What is the SMILES notation for CID 70118129?
The canonical SMILES for CID 70118129 is O=C(O)c1cccc([Si])c1O.
What is the InChIKey of CID 70118129?
The InChIKey is UGRHCPVHLZWTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5O3Si/c8-6-4(7(9)10)2-1-3-5(6)11/h1-3,8H,(H,9,10).
What are the key properties of CID 70118129?
CID 70118129 has a molecular weight of 165.20 g/mol, XLogP of -0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70118129 is sourced from PubChem (CID 70118129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).