C17H21NO2 — CID 135526001
2-(1-hydroxy-2-phenylethylidene)-5,5-dimethyl-3-methyliminocyclohexan-1-one (PubChem CID 135526001) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(1-hydroxy-2-phenylethylidene)-5,5-dimethyl-3-methyliminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-phenylethylidene)-5,5-dimethyl-3-methyliminocyclohexan-1-one |
|---|---|
| PubChem CID | 135526001 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(1-hydroxy-2-phenylethylidene)-5,5-dimethyl-3-methyliminocyclohexan-1-one |
| SMILES | C/N=C1\CC(C)(C)CC(=O)C1=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-17(2)10-13(18-3)16(15(20)11-17)14(19)9-12-7-5-4-6-8-12/h4-8,19H,9-11H2,1-3H3/b16-14?,18-13+ |
| InChIKey | YFEBVCJRTDJGNL-BLOLUTEISA-N |
| XLogP | 3.50 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|