C23H25NO2 — CID 135526129
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-prop-2-enyliminocyclohexan-1-one (PubChem CID 135526129) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-prop-2-enyliminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-prop-2-enyliminocyclohexan-1-one |
|---|---|
| PubChem CID | 135526129 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-prop-2-enyliminocyclohexan-1-one |
| SMILES | C=CC/N=C1\CC(C)(C)CC(=O)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H25NO2/c1-4-12-24-19-14-23(2,3)15-21(26)22(19)20(25)13-17-10-7-9-16-8-5-6-11-18(16)17/h4-11,25H,1,12-15H2,2-3H3/b22-20?,24-19+ |
| InChIKey | NFLOKWCSKLSQRB-KNRYKOOVSA-N |
| XLogP | 5.21 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|