C24H27NO4 — CID 135528349
methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-naphthalen-2-yliminocyclohex-2-ene-1-carboxylate (PubChem CID 135528349) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-naphthalen-2-yliminocyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-naphthalen-2-yliminocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 135528349 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-naphthalen-2-yliminocyclohex-2-ene-1-carboxylate |
| SMILES | CCCC(=O)C1=C(O)C(C(=O)OC)C(C)(C)C/C1=N\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27NO4/c1-5-8-19(26)20-18(14-24(2,3)21(22(20)27)23(28)29-4)25-17-12-11-15-9-6-7-10-16(15)13-17/h6-7,9-13,21,27H,5,8,14H2,1-4H3/b25-18+ |
| InChIKey | QVUGTXXCNQTSNF-XIEYBQDHSA-N |
| XLogP | 5.31 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|