C21H27NO5 — CID 135856647
methyl (1R)-3-butanoyl-2-hydroxy-4-(2-methoxyphenyl)imino-6,6-dimethylcyclohex-2-ene-1-carboxylate (PubChem CID 135856647) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl (1R)-3-butanoyl-2-hydroxy-4-(2-methoxyphenyl)imino-6,6-dimethylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R)-3-butanoyl-2-hydroxy-4-(2-methoxyphenyl)imino-6,6-dimethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 135856647 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | methyl (1R)-3-butanoyl-2-hydroxy-4-(2-methoxyphenyl)imino-6,6-dimethylcyclohex-2-ene-1-carboxylate |
| SMILES | CCCC(=O)C1=C(O)[C@H](C(=O)OC)C(C)(C)C/C1=N\c1ccccc1OC |
| InChI | InChI=1S/C21H27NO5/c1-6-9-15(23)17-14(22-13-10-7-8-11-16(13)26-4)12-21(2,3)18(19(17)24)20(25)27-5/h7-8,10-11,18,24H,6,9,12H2,1-5H3/b22-14+/t18-/m1/s1 |
| InChIKey | HQBOBJJSPWGLNK-SDLXJUDFSA-N |
| XLogP | 4.17 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|