C20H24N2O6 — CID 135423515
methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(4-nitrophenyl)iminocyclohex-2-ene-1-carboxylate (PubChem CID 135423515) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(4-nitrophenyl)iminocyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(4-nitrophenyl)iminocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 135423515 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 3-butanoyl-2-hydroxy-6,6-dimethyl-4-(4-nitrophenyl)iminocyclohex-2-ene-1-carboxylate |
| SMILES | CCCC(=O)C1=C(O)C(C(=O)OC)C(C)(C)C/C1=N\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N2O6/c1-5-6-15(23)16-14(21-12-7-9-13(10-8-12)22(26)27)11-20(2,3)17(18(16)24)19(25)28-4/h7-10,17,24H,5-6,11H2,1-4H3/b21-14+ |
| InChIKey | IGQJPBMQPLIVFN-KGENOOAVSA-N |
| XLogP | 4.07 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|