C16H24O4S — CID 788395
methyl (1R)-3-butanoyl-4-ethylsulfanyl-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 788395) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is methyl (1R)-3-butanoyl-4-ethylsulfanyl-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R)-3-butanoyl-4-ethylsulfanyl-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 788395 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl (1R)-3-butanoyl-4-ethylsulfanyl-6,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCCC(=O)C1=C(SCC)CC(C)(C)[C@@H](C(=O)OC)C1=O |
| InChI | InChI=1S/C16H24O4S/c1-6-8-10(17)12-11(21-7-2)9-16(3,4)13(14(12)18)15(19)20-5/h13H,6-9H2,1-5H3/t13-/m1/s1 |
| InChIKey | BUBCOZDKXIXSCP-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|