C18H27NO5 — CID 40535001
methyl (1R)-4-methoxy-6,6-dimethyl-2-oxo-3-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 40535001) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl (1R)-4-methoxy-6,6-dimethyl-2-oxo-3-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R)-4-methoxy-6,6-dimethyl-2-oxo-3-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 40535001 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methyl (1R)-4-methoxy-6,6-dimethyl-2-oxo-3-[(Z)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | C=CCO/N=C(/CCC)C1=C(OC)CC(C)(C)[C@@H](C(=O)OC)C1=O |
| InChI | InChI=1S/C18H27NO5/c1-7-9-12(19-24-10-8-2)14-13(22-5)11-18(3,4)15(16(14)20)17(21)23-6/h8,15H,2,7,9-11H2,1,3-6H3/b19-12-/t15-/m1/s1 |
| InChIKey | RMIGVJASGYIICQ-VUFYJBQKSA-N |
| XLogP | 3.03 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|