C24H19ClN4O6 — CID 135528469
2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-chloro-2-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid (PubChem CID 135528469) has the molecular formula C24H19ClN4O6 and a molecular weight of 494.89 g/mol. Its IUPAC name is 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-chloro-2-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid.
| Compound Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-chloro-2-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid |
|---|---|
| PubChem CID | 135528469 |
| Molecular Formula | C24H19ClN4O6 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-chloro-2-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cc(C(CC(=O)O)C(=O)O)cc(-c4cc(Cl)ccc4O)c3O)[nH]c2c1 |
| InChI | InChI=1S/C24H19ClN4O6/c25-12-2-4-19(30)14(8-12)15-5-11(13(24(34)35)9-20(31)32)6-16(21(15)33)23-28-17-3-1-10(22(26)27)7-18(17)29-23/h1-8,13,30,33H,9H2,(H3,26,27)(H,28,29)(H,31,32)(H,34,35) |
| InChIKey | QHNWGYJBPWRWJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|