C14H10ClN2O5P — CID 135532368
[4-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl] dihydrogen phosphate (PubChem CID 135532368) has the molecular formula C14H10ClN2O5P and a molecular weight of 352.67 g/mol. Its IUPAC name is [4-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl] dihydrogen phosphate.
| Compound Name | [4-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 135532368 |
| Molecular Formula | C14H10ClN2O5P |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | [4-chloro-2-(4-oxo-3H-quinazolin-2-yl)phenyl] dihydrogen phosphate |
| SMILES | O=c1[nH]c(-c2cc(Cl)ccc2OP(=O)(O)O)nc2ccccc12 |
| InChI | InChI=1S/C14H10ClN2O5P/c15-8-5-6-12(22-23(19,20)21)10(7-8)13-16-11-4-2-1-3-9(11)14(18)17-13/h1-7H,(H,16,17,18)(H2,19,20,21) |
| InChIKey | OSGMEKVRNKXUMC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|