C24H20N4O6 — CID 135532851
2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-4-hydroxy-5-(3-hydroxyphenyl)phenyl]butanedioic acid (PubChem CID 135532851) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-4-hydroxy-5-(3-hydroxyphenyl)phenyl]butanedioic acid.
| Compound Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-4-hydroxy-5-(3-hydroxyphenyl)phenyl]butanedioic acid |
|---|---|
| PubChem CID | 135532851 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-4-hydroxy-5-(3-hydroxyphenyl)phenyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cc(C(CC(=O)O)C(=O)O)cc(-c4cccc(O)c4)c3O)[nH]c2c1 |
| InChI | InChI=1S/C24H20N4O6/c25-22(26)12-4-5-18-19(9-12)28-23(27-18)17-8-13(16(24(33)34)10-20(30)31)7-15(21(17)32)11-2-1-3-14(29)6-11/h1-9,16,29,32H,10H2,(H3,25,26)(H,27,28)(H,30,31)(H,33,34) |
| InChIKey | AQESQZZCMQJOJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|