C16H16Br2N4O — CID 135533643
2,2-dibromo-1-methyl-N-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 135533643) has the molecular formula C16H16Br2N4O and a molecular weight of 440.14 g/mol. Its IUPAC name is 2,2-dibromo-1-methyl-N-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dibromo-1-methyl-N-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135533643 |
| Molecular Formula | C16H16Br2N4O |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 2,2-dibromo-1-methyl-N-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(-c2[nH]ncc2/C=N/NC(=O)C2(C)CC2(Br)Br)cc1 |
| InChI | InChI=1S/C16H16Br2N4O/c1-10-3-5-11(6-4-10)13-12(7-19-21-13)8-20-22-14(23)15(2)9-16(15,17)18/h3-8H,9H2,1-2H3,(H,19,21)(H,22,23)/b20-8+ |
| InChIKey | OXVFVMADJPECDI-DNTJNYDQSA-N |
| XLogP | 3.73 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|