C17H15BrN4O2 — CID 135533649
4-bromo-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 135533649) has the molecular formula C17H15BrN4O2 and a molecular weight of 387.24 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135533649 |
| Molecular Formula | C17H15BrN4O2 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 4-bromo-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1c(Br)c(C(=O)N/N=C/c2c(O)ccc3ccccc23)nn1C |
| InChI | InChI=1S/C17H15BrN4O2/c1-10-15(18)16(21-22(10)2)17(24)20-19-9-13-12-6-4-3-5-11(12)7-8-14(13)23/h3-9,23H,1-2H3,(H,20,24)/b19-9+ |
| InChIKey | VZMWEVJCADCLRO-DJKKODMXSA-N |
| XLogP | 3.11 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|