C23H22FN2O+ — CID 135534553
7-[(E)-2-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol (PubChem CID 135534553) has the molecular formula C23H22FN2O+ and a molecular weight of 361.44 g/mol. Its IUPAC name is 7-[(E)-2-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol.
| Compound Name | 7-[(E)-2-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol |
|---|---|
| PubChem CID | 135534553 |
| Molecular Formula | C23H22FN2O+ |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 7-[(E)-2-(5-fluoro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol |
| SMILES | Cc1cc(/C=C/C2=[N+](C)c3ccc(F)cc3C2(C)C)c(O)c2ncccc12 |
| InChI | InChI=1S/C23H21FN2O/c1-14-12-15(22(27)21-17(14)6-5-11-25-21)7-10-20-23(2,3)18-13-16(24)8-9-19(18)26(20)4/h5-13H,1-4H3/p+1 |
| InChIKey | YYDJDGVNYNWRIR-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 36.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|