C12H8N4O2 — CID 135538154
7-(4-hydroxyphenyl)-3H-pteridin-4-one (PubChem CID 135538154) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-3H-pteridin-4-one.
| Compound Name | 7-(4-hydroxyphenyl)-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135538154 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 7-(4-hydroxyphenyl)-3H-pteridin-4-one |
| SMILES | O=c1[nH]cnc2nc(-c3ccc(O)cc3)cnc12 |
| InChI | InChI=1S/C12H8N4O2/c17-8-3-1-7(2-4-8)9-5-13-10-11(16-9)14-6-15-12(10)18/h1-6,17H,(H,14,15,16,18) |
| InChIKey | VFCHWSVXSVXHCO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |