C18H21N5O4S — CID 135538404
N'-[(E)-(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 135538404) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is N'-[(E)-(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(E)-(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 135538404 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N'-[(E)-(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | CCn1c(O)c(/C=N/NC(=O)C(=O)Nc2ccc(C)cc2)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C18H21N5O4S/c1-4-22-16(26)13(17(27)23(5-2)18(22)28)10-19-21-15(25)14(24)20-12-8-6-11(3)7-9-12/h6-10,26H,4-5H2,1-3H3,(H,20,24)(H,21,25)/b19-10+ |
| InChIKey | NIOGGONHKPHQOP-VXLYETTFSA-N |
| XLogP | 1.52 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|