C43H30N2O12S — CID 135539207
[4,5'-dihydroxy-1',3,4'-tris(4-hydroxyphenyl)-3'-[2-(4-hydroxyphenyl)ethyl]-5-oxospiro[furan-2,2'-pyrrolo[3,2-g]carbazole]-7'-yl] hydrogen sulfate (PubChem CID 135539207) has the molecular formula C43H30N2O12S and a molecular weight of 798.78 g/mol. Its IUPAC name is [4,5'-dihydroxy-1',3,4'-tris(4-hydroxyphenyl)-3'-[2-(4-hydroxyphenyl)ethyl]-5-oxospiro[furan-2,2'-pyrrolo[3,2-g]carbazole]-7'-yl] hydrogen sulfate.
| Compound Name | [4,5'-dihydroxy-1',3,4'-tris(4-hydroxyphenyl)-3'-[2-(4-hydroxyphenyl)ethyl]-5-oxospiro[furan-2,2'-pyrrolo[3,2-g]carbazole]-7'-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135539207 |
| Molecular Formula | C43H30N2O12S |
| Molecular Weight | 798.78 g/mol |
| Exact Mass | 798.15 |
| IUPAC Name | [4,5'-dihydroxy-1',3,4'-tris(4-hydroxyphenyl)-3'-[2-(4-hydroxyphenyl)ethyl]-5-oxospiro[furan-2,2'-pyrrolo[3,2-g]carbazole]-7'-yl] hydrogen sulfate |
| SMILES | O=C1OC2(C(c3ccc(O)cc3)=C1O)C(c1ccc(O)cc1)=c1c(c(-c3ccc(O)cc3)c(O)c3c1=c1cccc(OS(=O)(=O)O)c1=N3)N2CCc1ccc(O)cc1 |
| InChI | InChI=1S/C43H30N2O12S/c46-26-12-4-22(5-13-26)20-21-45-39-32(23-6-14-27(47)15-7-23)40(50)38-33(30-2-1-3-31(37(30)44-38)57-58(53,54)55)34(39)35(24-8-16-28(48)17-9-24)43(45)36(41(51)42(52)56-43)25-10-18-29(49)19-11-25/h1-19,46-51H,20-21H2,(H,53,54,55) |
| InChIKey | NFRUORPOGPYJPK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 226.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.78 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|