C18H16N4O4 — CID 135541141
N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 135541141) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 135541141 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2cnc3ccccc3c2=O)ccc1O |
| InChI | InChI=1S/C18H16N4O4/c1-26-16-8-12(6-7-15(16)23)9-20-21-17(24)10-22-11-19-14-5-3-2-4-13(14)18(22)25/h2-9,11,23H,10H2,1H3,(H,21,24)/b20-9+ |
| InChIKey | JEPOZSCDXSENES-AWQFTUOYSA-N |
| XLogP | 1.26 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|