C17H13FN4O2 — CID 6209329
N-[(Z)-(4-fluorophenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 6209329) has the molecular formula C17H13FN4O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is N-[(Z)-(4-fluorophenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(Z)-(4-fluorophenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 6209329 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(Z)-(4-fluorophenyl)methylideneamino]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4O2/c18-13-7-5-12(6-8-13)9-20-21-16(23)10-22-11-19-15-4-2-1-3-14(15)17(22)24/h1-9,11H,10H2,(H,21,23)/b20-9- |
| InChIKey | WTAFRVRSXJVFJM-UKWGHVSLSA-N |
| XLogP | 1.69 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|