C20H20FN3O3 — CID 42572072
N-[4-(4-fluorophenoxy)butyl]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 42572072) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 42572072 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O3/c21-15-7-9-16(10-8-15)27-12-4-3-11-22-19(25)13-24-14-23-18-6-2-1-5-17(18)20(24)26/h1-2,5-10,14H,3-4,11-13H2,(H,22,25) |
| InChIKey | VATXQNJPOVICAD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|