C22H17N3O3S — CID 135541769
3-[2-[(2E)-2-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 135541769) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 3-[2-[(2E)-2-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[(2E)-2-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 135541769 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[2-[(2E)-2-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | C=CCc1cccc(/C=N/Nc2nc(-c3cc4ccccc4oc3=O)cs2)c1O |
| InChI | InChI=1S/C22H17N3O3S/c1-2-6-14-8-5-9-16(20(14)26)12-23-25-22-24-18(13-29-22)17-11-15-7-3-4-10-19(15)28-21(17)27/h2-5,7-13,26H,1,6H2,(H,24,25)/b23-12+ |
| InChIKey | BMXUAOGMWQAFOZ-FSJBWODESA-N |
| XLogP | 4.80 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|