C28H24CoF2N6O4 — CID 135542206
cobalt;bis((NZ,4Z)-N-[(3-fluoro-4-methoxyphenyl)methylidene]pyridine-4-carbohydrazonic acid) (PubChem CID 135542206) has the molecular formula C28H24CoF2N6O4 and a molecular weight of 605.47 g/mol. Its IUPAC name is cobalt;bis((NZ,4Z)-N-[(3-fluoro-4-methoxyphenyl)methylidene]pyridine-4-carbohydrazonic acid).
| Compound Name | cobalt;bis((NZ,4Z)-N-[(3-fluoro-4-methoxyphenyl)methylidene]pyridine-4-carbohydrazonic acid) |
|---|---|
| PubChem CID | 135542206 |
| Molecular Formula | C28H24CoF2N6O4 |
| Molecular Weight | 605.47 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | cobalt;bis((NZ,4Z)-N-[(3-fluoro-4-methoxyphenyl)methylidene]pyridine-4-carbohydrazonic acid) |
| SMILES | COc1ccc(/C=N/N=C(\O)c2ccncc2)cc1F.COc1ccc(/C=N/N=C(\O)c2ccncc2)cc1F.[Co] |
| InChI | InChI=1S/2C14H12FN3O2.Co/c2*1-20-13-3-2-10(8-12(13)15)9-17-18-14(19)11-4-6-16-7-5-11;/h2*2-9H,1H3,(H,18,19);/b2*17-9+; |
| InChIKey | OMDIKENBBMADRN-BCCLQLTPSA-N |
| XLogP | 5.13 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|