C12H8N2O2S — CID 135542318
7-hydroxy-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 135542318) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 7-hydroxy-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-hydroxy-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 135542318 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-hydroxy-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(O)nc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C12H8N2O2S/c15-10-6-11(16)14-9(7-17-12(14)13-10)8-4-2-1-3-5-8/h1-7,15H |
| InChIKey | VGSYONPCMZLPBZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |