C17H13N3S — CID 82068552
3,6-diphenylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82068552) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3,6-diphenylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 3,6-diphenylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82068552 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3,6-diphenylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Nc1c(-c2ccccc2)nc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C17H13N3S/c18-16-15(13-9-5-2-6-10-13)19-17-20(16)14(11-21-17)12-7-3-1-4-8-12/h1-11H,18H2 |
| InChIKey | LCKALMMUPZIXJY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |