C21H21N2O3PS — CID 132516192
5-diethoxyphosphoryl-3,6-diphenylimidazo[2,1-b][1,3]thiazole (PubChem CID 132516192) has the molecular formula C21H21N2O3PS and a molecular weight of 412.45 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-3,6-diphenylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-diethoxyphosphoryl-3,6-diphenylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 132516192 |
| Molecular Formula | C21H21N2O3PS |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 5-diethoxyphosphoryl-3,6-diphenylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccccc2)nc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C21H21N2O3PS/c1-3-25-27(24,26-4-2)20-19(17-13-9-6-10-14-17)22-21-23(20)18(15-28-21)16-11-7-5-8-12-16/h5-15H,3-4H2,1-2H3 |
| InChIKey | QRPYYONEMAAGRI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|