C13H13N3S — CID 82372908
6-ethyl-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82372908) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 6-ethyl-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 6-ethyl-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82372908 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 6-ethyl-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | CCc1nc2scc(-c3ccccc3)n2c1N |
| InChI | InChI=1S/C13H13N3S/c1-2-10-12(14)16-11(8-17-13(16)15-10)9-6-4-3-5-7-9/h3-8H,2,14H2,1H3 |
| InChIKey | WDLVIEFUPGGJDD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |